C24H23FN6O2 — CID 134407378
3-(4-fluorophenyl)-4-[(3-methyl-1,2-oxazol-4-yl)methyl]-12-(1-methylpyrazol-4-yl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one (PubChem CID 134407378) has the molecular formula C24H23FN6O2 and a molecular weight of 446.49 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-[(3-methyl-1,2-oxazol-4-yl)methyl]-12-(1-methylpyrazol-4-yl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one.
| Compound Name | 3-(4-fluorophenyl)-4-[(3-methyl-1,2-oxazol-4-yl)methyl]-12-(1-methylpyrazol-4-yl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one |
|---|---|
| PubChem CID | 134407378 |
| Molecular Formula | C24H23FN6O2 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 3-(4-fluorophenyl)-4-[(3-methyl-1,2-oxazol-4-yl)methyl]-12-(1-methylpyrazol-4-yl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one |
| SMILES | Cc1nocc1CN1CCN2C(=O)c3ccc(-c4cnn(C)c4)n3CC12c1ccc(F)cc1 |
| InChI | InChI=1S/C24H23FN6O2/c1-16-18(14-33-27-16)13-29-9-10-31-23(32)22-8-7-21(17-11-26-28(2)12-17)30(22)15-24(29,31)19-3-5-20(25)6-4-19/h3-8,11-12,14H,9-10,13,15H2,1-2H3 |
| InChIKey | RNQJRGXBJLZZIA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |