C22H23ClN2O2S — CID 134407601
2-[5-(4-chlorophenyl)-2,7,11-trimethyl-9-methylsulfanyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid (PubChem CID 134407601) has the molecular formula C22H23ClN2O2S and a molecular weight of 414.96 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-2,7,11-trimethyl-9-methylsulfanyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid.
| Compound Name | 2-[5-(4-chlorophenyl)-2,7,11-trimethyl-9-methylsulfanyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid |
|---|---|
| PubChem CID | 134407601 |
| Molecular Formula | C22H23ClN2O2S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-2,7,11-trimethyl-9-methylsulfanyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid |
| SMILES | CSN1CC(C)n2c(C)cc3c(-c4ccc(Cl)cc4)c(CC(=O)O)c(C)c1c32 |
| InChI | InChI=1S/C22H23ClN2O2S/c1-12-9-18-20(15-5-7-16(23)8-6-15)17(10-19(26)27)14(3)21-22(18)25(12)13(2)11-24(21)28-4/h5-9,13H,10-11H2,1-4H3,(H,26,27) |
| InChIKey | OEVAOTFGGKMCOG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|