C30H33ClN4O4 — CID 134407657
(2S)-2-[5-(4-chlorophenyl)-9-(5-methoxypyrimidin-2-yl)-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-pentoxyacetic acid (PubChem CID 134407657) has the molecular formula C30H33ClN4O4 and a molecular weight of 549.07 g/mol. Its IUPAC name is (2S)-2-[5-(4-chlorophenyl)-9-(5-methoxypyrimidin-2-yl)-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-pentoxyacetic acid.
| Compound Name | (2S)-2-[5-(4-chlorophenyl)-9-(5-methoxypyrimidin-2-yl)-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-pentoxyacetic acid |
|---|---|
| PubChem CID | 134407657 |
| Molecular Formula | C30H33ClN4O4 |
| Molecular Weight | 549.07 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | (2S)-2-[5-(4-chlorophenyl)-9-(5-methoxypyrimidin-2-yl)-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-pentoxyacetic acid |
| SMILES | CCCCCO[C@H](C(=O)O)c1c(C)c2c3c(cc(C)n3CCN2c2ncc(OC)cn2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H33ClN4O4/c1-5-6-7-14-39-28(29(36)37)24-19(3)26-27-23(25(24)20-8-10-21(31)11-9-20)15-18(2)34(27)12-13-35(26)30-32-16-22(38-4)17-33-30/h8-11,15-17,28H,5-7,12-14H2,1-4H3,(H,36,37)/t28-/m0/s1 |
| InChIKey | AAMOQWRHVUNZLQ-NDEPHWFRSA-N |
| XLogP | 6.86 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.07 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|