C27H28N6O4 — CID 134407744
3-(4-ethoxyphenyl)-11-(2-ethylpyrazol-3-yl)-4-(3-methyl-1,2-oxazole-4-carbonyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one (PubChem CID 134407744) has the molecular formula C27H28N6O4 and a molecular weight of 500.56 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-11-(2-ethylpyrazol-3-yl)-4-(3-methyl-1,2-oxazole-4-carbonyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one.
| Compound Name | 3-(4-ethoxyphenyl)-11-(2-ethylpyrazol-3-yl)-4-(3-methyl-1,2-oxazole-4-carbonyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one |
|---|---|
| PubChem CID | 134407744 |
| Molecular Formula | C27H28N6O4 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 3-(4-ethoxyphenyl)-11-(2-ethylpyrazol-3-yl)-4-(3-methyl-1,2-oxazole-4-carbonyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one |
| SMILES | CCOc1ccc(C23Cn4cc(-c5ccnn5CC)cc4C(=O)N2CCN3C(=O)c2conc2C)cc1 |
| InChI | InChI=1S/C27H28N6O4/c1-4-33-23(10-11-28-33)19-14-24-26(35)32-13-12-31(25(34)22-16-37-29-18(22)3)27(32,17-30(24)15-19)20-6-8-21(9-7-20)36-5-2/h6-11,14-16H,4-5,12-13,17H2,1-3H3 |
| InChIKey | WOINCFCFKXZTHO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 98.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |