About (4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne
(4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne (PubChem CID 134407838) has the molecular formula C9H9F3O2S
and a molecular weight of 238.23 g/mol. Its IUPAC name is (4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne.
Molecular Properties
| Compound Name | (4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne |
| PubChem CID | 134407838 |
| Molecular Formula | C9H9F3O2S |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | (4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne |
| SMILES | C#CC/C=C\C=C(/C)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H9F3O2S/c1-3-4-5-6-7-8(2)15(13,14)9(10,11)12/h1,5-7H,4H2,2H3/b6-5-,8-7+ |
| InChIKey | FMVUPSKNBLHXQO-IGTJQSIKSA-N |
| XLogP | 2.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne?
The IUPAC name of (4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne (CID 134407838) is (4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne.
What is the SMILES notation for (4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne?
The canonical SMILES for (4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne is C#CC/C=C\C=C(/C)S(=O)(=O)C(F)(F)F.
What is the InChIKey of (4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne?
The InChIKey is FMVUPSKNBLHXQO-IGTJQSIKSA-N. The full InChI is InChI=1S/C9H9F3O2S/c1-3-4-5-6-7-8(2)15(13,14)9(10,11)12/h1,5-7H,4H2,2H3/b6-5-,8-7+.
What are the key properties of (4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne?
(4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne has a molecular weight of 238.23 g/mol, XLogP of 2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,6E)-7-(trifluoromethylsulfonyl)octa-4,6-dien-1-yne is sourced from PubChem (CID 134407838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).