C24H25NO5 — CID 134408067
ethyl 5-[2-(1-butoxyethenyl)-4-phenoxyphenyl]-1,3-oxazole-4-carboxylate (PubChem CID 134408067) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is ethyl 5-[2-(1-butoxyethenyl)-4-phenoxyphenyl]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 5-[2-(1-butoxyethenyl)-4-phenoxyphenyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 134408067 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | ethyl 5-[2-(1-butoxyethenyl)-4-phenoxyphenyl]-1,3-oxazole-4-carboxylate |
| SMILES | C=C(OCCCC)c1cc(Oc2ccccc2)ccc1-c1ocnc1C(=O)OCC |
| InChI | InChI=1S/C24H25NO5/c1-4-6-14-28-17(3)21-15-19(30-18-10-8-7-9-11-18)12-13-20(21)23-22(25-16-29-23)24(26)27-5-2/h7-13,15-16H,3-6,14H2,1-2H3 |
| InChIKey | PADRAWGDNUEUGM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|