About 2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine
2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine (PubChem CID 134408083) has the molecular formula C18H29F3O2
and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine.
Molecular Properties
| Compound Name | 2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine |
| PubChem CID | 134408083 |
| Molecular Formula | C18H29F3O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine |
| SMILES | CCCC(CCCCC(C)C1=CCCC=C(C(F)(F)F)O1)OC |
| InChI | InChI=1S/C18H29F3O2/c1-4-9-15(22-3)11-6-5-10-14(2)16-12-7-8-13-17(23-16)18(19,20)21/h12-15H,4-11H2,1-3H3 |
| InChIKey | KUAYUAQBGCDSIR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine?
The IUPAC name of 2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine (CID 134408083) is 2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine.
What is the SMILES notation for 2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine?
The canonical SMILES for 2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine is CCCC(CCCCC(C)C1=CCCC=C(C(F)(F)F)O1)OC.
What is the InChIKey of 2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine?
The InChIKey is KUAYUAQBGCDSIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29F3O2/c1-4-9-15(22-3)11-6-5-10-14(2)16-12-7-8-13-17(23-16)18(19,20)21/h12-15H,4-11H2,1-3H3.
What are the key properties of 2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine?
2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine has a molecular weight of 334.42 g/mol, XLogP of 6.14, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-methoxydecan-2-yl)-7-(trifluoromethyl)-4,5-dihydrooxepine is sourced from PubChem (CID 134408083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).