C14H18F3IO2 — CID 134408111
(2R,6S)-2-(iodomethyl)-6-[(3Z,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]oxane (PubChem CID 134408111) has the molecular formula C14H18F3IO2 and a molecular weight of 402.19 g/mol. Its IUPAC name is (2R,6S)-2-(iodomethyl)-6-[(3Z,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]oxane.
| Compound Name | (2R,6S)-2-(iodomethyl)-6-[(3Z,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]oxane |
|---|---|
| PubChem CID | 134408111 |
| Molecular Formula | C14H18F3IO2 |
| Molecular Weight | 402.19 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | (2R,6S)-2-(iodomethyl)-6-[(3Z,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]oxane |
| SMILES | C=C(/C=C\C(=C/C)OC(F)(F)F)[C@@H]1CCC[C@H](CI)O1 |
| InChI | InChI=1S/C14H18F3IO2/c1-3-11(20-14(15,16)17)8-7-10(2)13-6-4-5-12(9-18)19-13/h3,7-8,12-13H,2,4-6,9H2,1H3/b8-7-,11-3+/t12-,13+/m1/s1 |
| InChIKey | VRECWWOMYRCSHG-ANYLKPTMSA-N |
| XLogP | 4.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.19 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|