C15H27NO — CID 134408117
1-[(2R,7S)-7-[(2E,4Z)-hepta-2,4-dien-3-yl]oxepan-2-yl]-N-methylmethanamine (PubChem CID 134408117) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-[(2R,7S)-7-[(2E,4Z)-hepta-2,4-dien-3-yl]oxepan-2-yl]-N-methylmethanamine.
| Compound Name | 1-[(2R,7S)-7-[(2E,4Z)-hepta-2,4-dien-3-yl]oxepan-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 134408117 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 1-[(2R,7S)-7-[(2E,4Z)-hepta-2,4-dien-3-yl]oxepan-2-yl]-N-methylmethanamine |
| SMILES | C/C=C(\C=C/CC)[C@@H]1CCCC[C@H](CNC)O1 |
| InChI | InChI=1S/C15H27NO/c1-4-6-9-13(5-2)15-11-8-7-10-14(17-15)12-16-3/h5-6,9,14-16H,4,7-8,10-12H2,1-3H3/b9-6-,13-5+/t14-,15+/m1/s1 |
| InChIKey | IWHUUQUJAROWDR-ZZXYVDSJSA-N |
| XLogP | 3.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|