About 6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid
6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid (PubChem CID 134408165) has the molecular formula C15H23N3O4
and a molecular weight of 309.37 g/mol. Its IUPAC name is 6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid |
| PubChem CID | 134408165 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid |
| SMILES | CC[C@@H]1CCC[C@H](CNc2nc(OC)nc(C(=O)O)c2C)O1 |
| InChI | InChI=1S/C15H23N3O4/c1-4-10-6-5-7-11(22-10)8-16-13-9(2)12(14(19)20)17-15(18-13)21-3/h10-11H,4-8H2,1-3H3,(H,19,20)(H,16,17,18)/t10-,11-/m1/s1 |
| InChIKey | QSRULLNNDPGPFQ-GHMZBOCLSA-N |
| XLogP | 2.25 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid?
The IUPAC name of 6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid (CID 134408165) is 6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid.
What is the SMILES notation for 6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid?
The canonical SMILES for 6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid is CC[C@@H]1CCC[C@H](CNc2nc(OC)nc(C(=O)O)c2C)O1.
What is the InChIKey of 6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid?
The InChIKey is QSRULLNNDPGPFQ-GHMZBOCLSA-N. The full InChI is InChI=1S/C15H23N3O4/c1-4-10-6-5-7-11(22-10)8-16-13-9(2)12(14(19)20)17-15(18-13)21-3/h10-11H,4-8H2,1-3H3,(H,19,20)(H,16,17,18)/t10-,11-/m1/s1.
What are the key properties of 6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid?
6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid has a molecular weight of 309.37 g/mol, XLogP of 2.25, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(2R,6R)-6-ethyloxan-2-yl]methylamino]-2-methoxy-5-methylpyrimidine-4-carboxylic acid is sourced from PubChem (CID 134408165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).