C13H20F3NO — CID 134408179
[(2R,6S)-6-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]oxan-2-yl]methanamine (PubChem CID 134408179) has the molecular formula C13H20F3NO and a molecular weight of 263.30 g/mol. Its IUPAC name is [(2R,6S)-6-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]oxan-2-yl]methanamine.
| Compound Name | [(2R,6S)-6-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]oxan-2-yl]methanamine |
|---|---|
| PubChem CID | 134408179 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | [(2R,6S)-6-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]oxan-2-yl]methanamine |
| SMILES | C/C(=C\C=C(/C)C(F)(F)F)[C@@H]1CCC[C@H](CN)O1 |
| InChI | InChI=1S/C13H20F3NO/c1-9(6-7-10(2)13(14,15)16)12-5-3-4-11(8-17)18-12/h6-7,11-12H,3-5,8,17H2,1-2H3/b9-6+,10-7+/t11-,12+/m1/s1 |
| InChIKey | SUEFSWDIWFKNIS-XBSSAXJASA-N |
| XLogP | 3.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|