C14H19F3O — CID 134408214
(6S,7E,8Z)-11,11,11-trifluoro-7-prop-2-enylideneundeca-1,8-dien-6-ol (PubChem CID 134408214) has the molecular formula C14H19F3O and a molecular weight of 260.30 g/mol. Its IUPAC name is (6S,7E,8Z)-11,11,11-trifluoro-7-prop-2-enylideneundeca-1,8-dien-6-ol.
| Compound Name | (6S,7E,8Z)-11,11,11-trifluoro-7-prop-2-enylideneundeca-1,8-dien-6-ol |
|---|---|
| PubChem CID | 134408214 |
| Molecular Formula | C14H19F3O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (6S,7E,8Z)-11,11,11-trifluoro-7-prop-2-enylideneundeca-1,8-dien-6-ol |
| SMILES | C=C/C=C(\C=C/CC(F)(F)F)[C@@H](O)CCCC=C |
| InChI | InChI=1S/C14H19F3O/c1-3-5-6-10-13(18)12(8-4-2)9-7-11-14(15,16)17/h3-4,7-9,13,18H,1-2,5-6,10-11H2/b9-7-,12-8+/t13-/m0/s1 |
| InChIKey | GRBWULKSMWVJFN-DQIDJNQTSA-N |
| XLogP | 4.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|