About (1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine
(1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine (PubChem CID 134408995) has the molecular formula C11H17F2NO
and a molecular weight of 217.26 g/mol. Its IUPAC name is (1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine.
Molecular Properties
| Compound Name | (1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine |
| PubChem CID | 134408995 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine |
| SMILES | CC/C=C1/OCCC(F)(F)/C1=C/C(C)N |
| InChI | InChI=1S/C11H17F2NO/c1-3-4-10-9(7-8(2)14)11(12,13)5-6-15-10/h4,7-8H,3,5-6,14H2,1-2H3/b9-7+,10-4+ |
| InChIKey | FMECLXRLRDHGSY-FXLUECPISA-N |
| XLogP | 2.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine?
The IUPAC name of (1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine (CID 134408995) is (1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine.
What is the SMILES notation for (1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine?
The canonical SMILES for (1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine is CC/C=C1/OCCC(F)(F)/C1=C/C(C)N.
What is the InChIKey of (1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine?
The InChIKey is FMECLXRLRDHGSY-FXLUECPISA-N. The full InChI is InChI=1S/C11H17F2NO/c1-3-4-10-9(7-8(2)14)11(12,13)5-6-15-10/h4,7-8H,3,5-6,14H2,1-2H3/b9-7+,10-4+.
What are the key properties of (1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine?
(1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine has a molecular weight of 217.26 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-[(2E)-4,4-difluoro-2-propylideneoxan-3-ylidene]propan-2-amine is sourced from PubChem (CID 134408995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).