C17H19FN4O2 — CID 134409049
N-[4-[3-fluoro-4-(methylaminomethylamino)phenoxy]-2-pyridinyl]cyclopropanecarboxamide (PubChem CID 134409049) has the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. Its IUPAC name is N-[4-[3-fluoro-4-(methylaminomethylamino)phenoxy]-2-pyridinyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[3-fluoro-4-(methylaminomethylamino)phenoxy]-2-pyridinyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 134409049 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-[4-[3-fluoro-4-(methylaminomethylamino)phenoxy]-2-pyridinyl]cyclopropanecarboxamide |
| SMILES | CNCNc1ccc(Oc2ccnc(NC(=O)C3CC3)c2)cc1F |
| InChI | InChI=1S/C17H19FN4O2/c1-19-10-21-15-5-4-12(8-14(15)18)24-13-6-7-20-16(9-13)22-17(23)11-2-3-11/h4-9,11,19,21H,2-3,10H2,1H3,(H,20,22,23) |
| InChIKey | BSAGNJRIDRWJJV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|