C13H22N2 — CID 134409241
N'-[(2E,4E)-2,5,6-trimethylhepta-2,4,6-trienyl]propanimidamide (PubChem CID 134409241) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N'-[(2E,4E)-2,5,6-trimethylhepta-2,4,6-trienyl]propanimidamide.
| Compound Name | N'-[(2E,4E)-2,5,6-trimethylhepta-2,4,6-trienyl]propanimidamide |
|---|---|
| PubChem CID | 134409241 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N'-[(2E,4E)-2,5,6-trimethylhepta-2,4,6-trienyl]propanimidamide |
| SMILES | C=C(C)/C(C)=C/C=C(\C)C/N=C(/N)CC |
| InChI | InChI=1S/C13H22N2/c1-6-13(14)15-9-11(4)7-8-12(5)10(2)3/h7-8H,2,6,9H2,1,3-5H3,(H2,14,15)/b11-7+,12-8+ |
| InChIKey | YGURHMQYZAJITJ-MKICQXMISA-N |
| XLogP | 3.22 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|