C15H16N2S — CID 134409520
1-[(1Z)-buta-1,3-dienyl]-2-ethyl-5,6-dihydro-[1,3]thiazolo[3,2-a]benzimidazole (PubChem CID 134409520) has the molecular formula C15H16N2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-2-ethyl-5,6-dihydro-[1,3]thiazolo[3,2-a]benzimidazole.
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-2-ethyl-5,6-dihydro-[1,3]thiazolo[3,2-a]benzimidazole |
|---|---|
| PubChem CID | 134409520 |
| Molecular Formula | C15H16N2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-2-ethyl-5,6-dihydro-[1,3]thiazolo[3,2-a]benzimidazole |
| SMILES | C=C/C=C\c1c(CC)sc2nc3c(n12)C=CCC3 |
| InChI | InChI=1S/C15H16N2S/c1-3-5-9-13-14(4-2)18-15-16-11-8-6-7-10-12(11)17(13)15/h3,5,7,9-10H,1,4,6,8H2,2H3/b9-5- |
| InChIKey | NQMUPZSXKITCOB-UITAMQMPSA-N |
| XLogP | 4.12 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|