C15H14N2O — CID 134409654
1-[(1Z)-buta-1,3-dienyl]-2-ethylimidazo[2,1-b][1,3]benzoxazole (PubChem CID 134409654) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-2-ethylimidazo[2,1-b][1,3]benzoxazole.
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-2-ethylimidazo[2,1-b][1,3]benzoxazole |
|---|---|
| PubChem CID | 134409654 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-2-ethylimidazo[2,1-b][1,3]benzoxazole |
| SMILES | C=C/C=C\c1c(CC)nc2oc3ccccc3n12 |
| InChI | InChI=1S/C15H14N2O/c1-3-5-8-12-11(4-2)16-15-17(12)13-9-6-7-10-14(13)18-15/h3,5-10H,1,4H2,2H3/b8-5- |
| InChIKey | OMNSCRYYTPZALF-YVMONPNESA-N |
| XLogP | 3.84 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|