About N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine
N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine (PubChem CID 134409768) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine.
Molecular Properties
| Compound Name | N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine |
| PubChem CID | 134409768 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine |
| SMILES | C=NC1=C(N2COc3ccccc32)C=CCC1 |
| InChI | InChI=1S/C14H14N2O/c1-15-11-6-2-3-7-12(11)16-10-17-14-9-5-4-8-13(14)16/h3-5,7-9H,1-2,6,10H2 |
| InChIKey | VGHFRQGCRKCYBV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine?
The IUPAC name of N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine (CID 134409768) is N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine.
What is the SMILES notation for N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine?
The canonical SMILES for N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine is C=NC1=C(N2COc3ccccc32)C=CCC1.
What is the InChIKey of N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine?
The InChIKey is VGHFRQGCRKCYBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O/c1-15-11-6-2-3-7-12(11)16-10-17-14-9-5-4-8-13(14)16/h3-5,7-9H,1-2,6,10H2.
What are the key properties of N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine?
N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine has a molecular weight of 226.28 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2H-1,3-benzoxazol-3-yl)cyclohexa-1,3-dien-1-yl]methanimine is sourced from PubChem (CID 134409768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).