C19H23F2N3O3 — CID 134410312
1-[4-[(2R)-2-(9,10-diazatricyclo[6.3.0.03,6]undeca-1,3(6),7,10-tetraen-7-yl)-1,1-difluoro-2-hydroxyethyl]piperidin-1-yl]-2-methoxyethanone (PubChem CID 134410312) has the molecular formula C19H23F2N3O3 and a molecular weight of 379.41 g/mol. Its IUPAC name is 1-[4-[(2R)-2-(9,10-diazatricyclo[6.3.0.03,6]undeca-1,3(6),7,10-tetraen-7-yl)-1,1-difluoro-2-hydroxyethyl]piperidin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[4-[(2R)-2-(9,10-diazatricyclo[6.3.0.03,6]undeca-1,3(6),7,10-tetraen-7-yl)-1,1-difluoro-2-hydroxyethyl]piperidin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 134410312 |
| Molecular Formula | C19H23F2N3O3 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 1-[4-[(2R)-2-(9,10-diazatricyclo[6.3.0.03,6]undeca-1,3(6),7,10-tetraen-7-yl)-1,1-difluoro-2-hydroxyethyl]piperidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC(C(F)(F)[C@H](O)c2c3c(cc4cn[nH]c24)CC3)CC1 |
| InChI | InChI=1S/C19H23F2N3O3/c1-27-10-15(25)24-6-4-13(5-7-24)19(20,21)18(26)16-14-3-2-11(14)8-12-9-22-23-17(12)16/h8-9,13,18,26H,2-7,10H2,1H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | MAGBAUHNFOCLIR-GOSISDBHSA-N |
| XLogP | 2.22 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |