About amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate
amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate (PubChem CID 134410383) has the molecular formula C23H21N3O6S
and a molecular weight of 467.50 g/mol. Its IUPAC name is amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate.
Molecular Properties
| Compound Name | amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate |
| PubChem CID | 134410383 |
| Molecular Formula | C23H21N3O6S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate |
| SMILES | Cc1ccc(-c2cc(COc3ccc(O)cc3O)nn2-c2ccc(S(=O)(=O)ON)cc2)cc1 |
| InChI | InChI=1S/C23H21N3O6S/c1-15-2-4-16(5-3-15)21-12-17(14-31-23-11-8-19(27)13-22(23)28)25-26(21)18-6-9-20(10-7-18)33(29,30)32-24/h2-13,27-28H,14,24H2,1H3 |
| InChIKey | LPKZOTOJLMVKMA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate?
The IUPAC name of amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate (CID 134410383) is amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate.
What is the SMILES notation for amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate?
The canonical SMILES for amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate is Cc1ccc(-c2cc(COc3ccc(O)cc3O)nn2-c2ccc(S(=O)(=O)ON)cc2)cc1.
What is the InChIKey of amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate?
The InChIKey is LPKZOTOJLMVKMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3O6S/c1-15-2-4-16(5-3-15)21-12-17(14-31-23-11-8-19(27)13-22(23)28)25-26(21)18-6-9-20(10-7-18)33(29,30)32-24/h2-13,27-28H,14,24H2,1H3.
What are the key properties of amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate?
amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate has a molecular weight of 467.50 g/mol, XLogP of 3.42, 7 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for amino 4-[3-[(2,4-dihydroxyphenoxy)methyl]-5-(4-methylphenyl)pyrazol-1-yl]benzenesulfonate is sourced from PubChem (CID 134410383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).