About 2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole
2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole (PubChem CID 134411058) has the molecular formula C16H22FNOS
and a molecular weight of 295.42 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole |
| PubChem CID | 134411058 |
| Molecular Formula | C16H22FNOS |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole |
| SMILES | CC(C)(C)c1cc(OCF)c2nc(C(C)(C)C)sc2c1 |
| InChI | InChI=1S/C16H22FNOS/c1-15(2,3)10-7-11(19-9-17)13-12(8-10)20-14(18-13)16(4,5)6/h7-8H,9H2,1-6H3 |
| InChIKey | HPNFSLZFRXZNHG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole?
The IUPAC name of 2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole (CID 134411058) is 2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole.
What is the SMILES notation for 2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole?
The canonical SMILES for 2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole is CC(C)(C)c1cc(OCF)c2nc(C(C)(C)C)sc2c1.
What is the InChIKey of 2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole?
The InChIKey is HPNFSLZFRXZNHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22FNOS/c1-15(2,3)10-7-11(19-9-17)13-12(8-10)20-14(18-13)16(4,5)6/h7-8H,9H2,1-6H3.
What are the key properties of 2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole?
2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole has a molecular weight of 295.42 g/mol, XLogP of 5.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-(fluoromethoxy)-1,3-benzothiazole is sourced from PubChem (CID 134411058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).