About (2-phenyl-1,3-thiazol-5-yl) thiohypofluorite
(2-phenyl-1,3-thiazol-5-yl) thiohypofluorite (PubChem CID 134411374) has the molecular formula C9H6FNS2
and a molecular weight of 211.29 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-5-yl) thiohypofluorite.
Molecular Properties
| Compound Name | (2-phenyl-1,3-thiazol-5-yl) thiohypofluorite |
| PubChem CID | 134411374 |
| Molecular Formula | C9H6FNS2 |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | (2-phenyl-1,3-thiazol-5-yl) thiohypofluorite |
| SMILES | FSc1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C9H6FNS2/c10-13-8-6-11-9(12-8)7-4-2-1-3-5-7/h1-6H |
| InChIKey | BUKXCMGEENFGTE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-phenyl-1,3-thiazol-5-yl) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-1,3-thiazol-5-yl) thiohypofluorite?
The IUPAC name of (2-phenyl-1,3-thiazol-5-yl) thiohypofluorite (CID 134411374) is (2-phenyl-1,3-thiazol-5-yl) thiohypofluorite.
What is the SMILES notation for (2-phenyl-1,3-thiazol-5-yl) thiohypofluorite?
The canonical SMILES for (2-phenyl-1,3-thiazol-5-yl) thiohypofluorite is FSc1cnc(-c2ccccc2)s1.
What is the InChIKey of (2-phenyl-1,3-thiazol-5-yl) thiohypofluorite?
The InChIKey is BUKXCMGEENFGTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FNS2/c10-13-8-6-11-9(12-8)7-4-2-1-3-5-7/h1-6H.
What are the key properties of (2-phenyl-1,3-thiazol-5-yl) thiohypofluorite?
(2-phenyl-1,3-thiazol-5-yl) thiohypofluorite has a molecular weight of 211.29 g/mol, XLogP of 3.79, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-1,3-thiazol-5-yl) thiohypofluorite is sourced from PubChem (CID 134411374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).