C22H24ClN5O2 — CID 134411442
4-(9-chloro-6-hydroxy-5-methyl-3,4-diazatricyclo[5.3.1.04,11]undeca-1(11),2,7,9-tetraen-5-yl)-N-(pyridin-2-ylmethyl)piperidine-1-carboxamide (PubChem CID 134411442) has the molecular formula C22H24ClN5O2 and a molecular weight of 425.92 g/mol. Its IUPAC name is 4-(9-chloro-6-hydroxy-5-methyl-3,4-diazatricyclo[5.3.1.04,11]undeca-1(11),2,7,9-tetraen-5-yl)-N-(pyridin-2-ylmethyl)piperidine-1-carboxamide.
| Compound Name | 4-(9-chloro-6-hydroxy-5-methyl-3,4-diazatricyclo[5.3.1.04,11]undeca-1(11),2,7,9-tetraen-5-yl)-N-(pyridin-2-ylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 134411442 |
| Molecular Formula | C22H24ClN5O2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 4-(9-chloro-6-hydroxy-5-methyl-3,4-diazatricyclo[5.3.1.04,11]undeca-1(11),2,7,9-tetraen-5-yl)-N-(pyridin-2-ylmethyl)piperidine-1-carboxamide |
| SMILES | CC1(C2CCN(C(=O)NCc3ccccn3)CC2)C(O)c2cc(Cl)cc3cnn1c23 |
| InChI | InChI=1S/C22H24ClN5O2/c1-22(20(29)18-11-16(23)10-14-12-26-28(22)19(14)18)15-5-8-27(9-6-15)21(30)25-13-17-4-2-3-7-24-17/h2-4,7,10-12,15,20,29H,5-6,8-9,13H2,1H3,(H,25,30) |
| InChIKey | MAVPUKNKNSPVCB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |