About 1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol
1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol (PubChem CID 134411510) has the molecular formula C11H12Cl2N2O
and a molecular weight of 259.14 g/mol. Its IUPAC name is 1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol |
| PubChem CID | 134411510 |
| Molecular Formula | C11H12Cl2N2O |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol |
| SMILES | CC(C)C(O)c1c(Cl)c(Cl)cc2cn[nH]c12 |
| InChI | InChI=1S/C11H12Cl2N2O/c1-5(2)11(16)8-9(13)7(12)3-6-4-14-15-10(6)8/h3-5,11,16H,1-2H3,(H,14,15) |
| InChIKey | XVIYKVPTSHQLSI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol?
The IUPAC name of 1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol (CID 134411510) is 1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol.
What is the SMILES notation for 1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol?
The canonical SMILES for 1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol is CC(C)C(O)c1c(Cl)c(Cl)cc2cn[nH]c12.
What is the InChIKey of 1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol?
The InChIKey is XVIYKVPTSHQLSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2N2O/c1-5(2)11(16)8-9(13)7(12)3-6-4-14-15-10(6)8/h3-5,11,16H,1-2H3,(H,14,15).
What are the key properties of 1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol?
1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol has a molecular weight of 259.14 g/mol, XLogP of 3.56, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-dichloro-1H-indazol-7-yl)-2-methylpropan-1-ol is sourced from PubChem (CID 134411510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).