C40H30F2N2S2 — CID 134411569
3,8-bis(5,5-dimethyldibenzothiophen-2-yl)-5,6-difluoro-1,10-phenanthroline (PubChem CID 134411569) has the molecular formula C40H30F2N2S2 and a molecular weight of 640.82 g/mol. Its IUPAC name is 3,8-bis(5,5-dimethyldibenzothiophen-2-yl)-5,6-difluoro-1,10-phenanthroline.
| Compound Name | 3,8-bis(5,5-dimethyldibenzothiophen-2-yl)-5,6-difluoro-1,10-phenanthroline |
|---|---|
| PubChem CID | 134411569 |
| Molecular Formula | C40H30F2N2S2 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.18 |
| IUPAC Name | 3,8-bis(5,5-dimethyldibenzothiophen-2-yl)-5,6-difluoro-1,10-phenanthroline |
| SMILES | CS1(C)c2ccccc2-c2cc(-c3cnc4c(c3)c(F)c(F)c3cc(-c5ccc6c(c5)-c5ccccc5S6(C)C)cnc34)ccc21 |
| InChI | InChI=1S/C40H30F2N2S2/c1-45(2)33-11-7-5-9-27(33)29-17-23(13-15-35(29)45)25-19-31-37(41)38(42)32-20-26(22-44-40(32)39(31)43-21-25)24-14-16-36-30(18-24)28-10-6-8-12-34(28)46(36,3)4/h5-22H,1-4H3 |
| InChIKey | PWRSPFZKHVONME-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|