C17H14ClF2N3O2 — CID 134412013
(3S,4S)-N-(3-chloro-2-pyridinyl)-4-(3,5-difluorophenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 134412013) has the molecular formula C17H14ClF2N3O2 and a molecular weight of 365.77 g/mol. Its IUPAC name is (3S,4S)-N-(3-chloro-2-pyridinyl)-4-(3,5-difluorophenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-N-(3-chloro-2-pyridinyl)-4-(3,5-difluorophenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412013 |
| Molecular Formula | C17H14ClF2N3O2 |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | (3S,4S)-N-(3-chloro-2-pyridinyl)-4-(3,5-difluorophenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | CN1C[C@H](c2cc(F)cc(F)c2)[C@@H](C(=O)Nc2ncccc2Cl)C1=O |
| InChI | InChI=1S/C17H14ClF2N3O2/c1-23-8-12(9-5-10(19)7-11(20)6-9)14(17(23)25)16(24)22-15-13(18)3-2-4-21-15/h2-7,12,14H,8H2,1H3,(H,21,22,24)/t12-,14+/m1/s1 |
| InChIKey | SCPROBLEYGJLRZ-OCCSQVGLSA-N |
| XLogP | 2.82 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|