C20H20F2N2O3S — CID 134412111
(3S,4S)-4-[4-(difluoromethoxy)phenyl]-1-methyl-N-(2-methylsulfanylphenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 134412111) has the molecular formula C20H20F2N2O3S and a molecular weight of 406.45 g/mol. Its IUPAC name is (3S,4S)-4-[4-(difluoromethoxy)phenyl]-1-methyl-N-(2-methylsulfanylphenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-4-[4-(difluoromethoxy)phenyl]-1-methyl-N-(2-methylsulfanylphenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412111 |
| Molecular Formula | C20H20F2N2O3S |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (3S,4S)-4-[4-(difluoromethoxy)phenyl]-1-methyl-N-(2-methylsulfanylphenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | CSc1ccccc1NC(=O)[C@H]1C(=O)N(C)C[C@@H]1c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H20F2N2O3S/c1-24-11-14(12-7-9-13(10-8-12)27-20(21)22)17(19(24)26)18(25)23-15-5-3-4-6-16(15)28-2/h3-10,14,17,20H,11H2,1-2H3,(H,23,25)/t14-,17+/m1/s1 |
| InChIKey | NELWBANTGLNKTJ-PBHICJAKSA-N |
| XLogP | 3.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|