C17H12F5N3O2 — CID 134412253
(3R,4S)-N-(2,3-difluorophenyl)-2-oxo-4-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide (PubChem CID 134412253) has the molecular formula C17H12F5N3O2 and a molecular weight of 385.29 g/mol. Its IUPAC name is (3R,4S)-N-(2,3-difluorophenyl)-2-oxo-4-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-N-(2,3-difluorophenyl)-2-oxo-4-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412253 |
| Molecular Formula | C17H12F5N3O2 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | (3R,4S)-N-(2,3-difluorophenyl)-2-oxo-4-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide |
| SMILES | O=C1NC[C@H](c2cncc(C(F)(F)F)c2)[C@H]1C(=O)Nc1cccc(F)c1F |
| InChI | InChI=1S/C17H12F5N3O2/c18-11-2-1-3-12(14(11)19)25-16(27)13-10(7-24-15(13)26)8-4-9(6-23-5-8)17(20,21)22/h1-6,10,13H,7H2,(H,24,26)(H,25,27)/t10-,13-/m1/s1 |
| InChIKey | MXZQVNKGMXRCES-ZWNOBZJWSA-N |
| XLogP | 2.85 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|