C26H32N2 — CID 134413186
3'-[(4aR,10bS)-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]isoquinolin-9-yl]spiro[1,2-dihydroindene-3,4'-piperidine] (PubChem CID 134413186) has the molecular formula C26H32N2 and a molecular weight of 372.56 g/mol. Its IUPAC name is 3'-[(4aR,10bS)-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]isoquinolin-9-yl]spiro[1,2-dihydroindene-3,4'-piperidine].
| Compound Name | 3'-[(4aR,10bS)-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]isoquinolin-9-yl]spiro[1,2-dihydroindene-3,4'-piperidine] |
|---|---|
| PubChem CID | 134413186 |
| Molecular Formula | C26H32N2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 3'-[(4aR,10bS)-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]isoquinolin-9-yl]spiro[1,2-dihydroindene-3,4'-piperidine] |
| SMILES | c1ccc2c(c1)CCC21CCNCC1c1ccc2c(c1)[C@H]1CCNC[C@@H]1CC2 |
| InChI | InChI=1S/C26H32N2/c1-2-4-24-19(3-1)9-11-26(24)12-14-28-17-25(26)20-7-5-18-6-8-21-16-27-13-10-22(21)23(18)15-20/h1-5,7,15,21-22,25,27-28H,6,8-14,16-17H2/t21-,22-,25?,26?/m0/s1 |
| InChIKey | LOCKZSCOSDQUIK-FPMFRTRJSA-N |
| XLogP | 4.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |