About 3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid
3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid (PubChem CID 134413232) has the molecular formula C10H6BrCl2F5O2S
and a molecular weight of 436.02 g/mol. Its IUPAC name is 3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid |
| PubChem CID | 134413232 |
| Molecular Formula | C10H6BrCl2F5O2S |
| Molecular Weight | 436.02 g/mol |
| Exact Mass | 433.86 |
| IUPAC Name | 3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1C(c2cc(Br)cc(S(F)(F)(F)(F)F)c2)C1(Cl)Cl |
| InChI | InChI=1S/C10H6BrCl2F5O2S/c11-5-1-4(7-8(9(19)20)10(7,12)13)2-6(3-5)21(14,15,16,17)18/h1-3,7-8H,(H,19,20) |
| InChIKey | PMVFYCLSVLTBND-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.02 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid?
The IUPAC name of 3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid (CID 134413232) is 3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid.
What is the SMILES notation for 3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid?
The canonical SMILES for 3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid is O=C(O)C1C(c2cc(Br)cc(S(F)(F)(F)(F)F)c2)C1(Cl)Cl.
What is the InChIKey of 3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid?
The InChIKey is PMVFYCLSVLTBND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrCl2F5O2S/c11-5-1-4(7-8(9(19)20)10(7,12)13)2-6(3-5)21(14,15,16,17)18/h1-3,7-8H,(H,19,20).
What are the key properties of 3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid?
3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid has a molecular weight of 436.02 g/mol, XLogP of 6.08, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid is sourced from PubChem (CID 134413232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).