About ethyl 4-phenyl-1,3-thiazole-5-carboxylate
ethyl 4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 13441325) has the molecular formula C12H11NO2S
and a molecular weight of 233.29 g/mol. Its IUPAC name is ethyl 4-phenyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-phenyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 13441325 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | ethyl 4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1scnc1-c1ccccc1 |
| InChI | InChI=1S/C12H11NO2S/c1-2-15-12(14)11-10(13-8-16-11)9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
| InChIKey | VUBSBLCFFDSRJO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-phenyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-phenyl-1,3-thiazole-5-carboxylate?
The IUPAC name of ethyl 4-phenyl-1,3-thiazole-5-carboxylate (CID 13441325) is ethyl 4-phenyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for ethyl 4-phenyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for ethyl 4-phenyl-1,3-thiazole-5-carboxylate is CCOC(=O)c1scnc1-c1ccccc1.
What is the InChIKey of ethyl 4-phenyl-1,3-thiazole-5-carboxylate?
The InChIKey is VUBSBLCFFDSRJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2S/c1-2-15-12(14)11-10(13-8-16-11)9-6-4-3-5-7-9/h3-8H,2H2,1H3.
What are the key properties of ethyl 4-phenyl-1,3-thiazole-5-carboxylate?
ethyl 4-phenyl-1,3-thiazole-5-carboxylate has a molecular weight of 233.29 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-phenyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 13441325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).