C13H20ClNO — CID 134414222
4-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]azepan-4-ol (PubChem CID 134414222) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is 4-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]azepan-4-ol.
| Compound Name | 4-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]azepan-4-ol |
|---|---|
| PubChem CID | 134414222 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]azepan-4-ol |
| SMILES | C=C(/C=C\C(Cl)=C/C)C1(O)CCCNCC1 |
| InChI | InChI=1S/C13H20ClNO/c1-3-12(14)6-5-11(2)13(16)7-4-9-15-10-8-13/h3,5-6,15-16H,2,4,7-10H2,1H3/b6-5-,12-3+ |
| InChIKey | DRTKNJDZYRGQEY-JQFMXUTPSA-N |
| XLogP | 2.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|