C17H30ClN5O6S — CID 134414661
2-chloro-N-[2-[2-[2-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 134414661) has the molecular formula C17H30ClN5O6S and a molecular weight of 467.98 g/mol. Its IUPAC name is 2-chloro-N-[2-[2-[2-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2-chloro-N-[2-[2-[2-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 134414661 |
| Molecular Formula | C17H30ClN5O6S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 2-chloro-N-[2-[2-[2-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | O=C(CCl)NCCOCCOCCOCCn1cc(CN2CCS(=O)(=O)CC2)nn1 |
| InChI | InChI=1S/C17H30ClN5O6S/c18-13-17(24)19-1-5-27-7-9-29-10-8-28-6-2-23-15-16(20-21-23)14-22-3-11-30(25,26)12-4-22/h15H,1-14H2,(H,19,24) |
| InChIKey | FHAMJXAHMZGHJG-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|