C23H27FN3O10P — CID 134414836
(1R,9S,11S,14R,16R,17R)-16-(2,4-dioxopyrimidin-1-yl)-17-fluoro-9,17-dimethyl-11-oxo-11-phenoxy-2,7,12,15-tetraoxa-10-aza-11λ5-phosphabicyclo[12.3.0]heptadecane-3,8-dione (PubChem CID 134414836) has the molecular formula C23H27FN3O10P and a molecular weight of 555.45 g/mol. Its IUPAC name is (1R,9S,11S,14R,16R,17R)-16-(2,4-dioxopyrimidin-1-yl)-17-fluoro-9,17-dimethyl-11-oxo-11-phenoxy-2,7,12,15-tetraoxa-10-aza-11λ5-phosphabicyclo[12.3.0]heptadecane-3,8-dione.
| Compound Name | (1R,9S,11S,14R,16R,17R)-16-(2,4-dioxopyrimidin-1-yl)-17-fluoro-9,17-dimethyl-11-oxo-11-phenoxy-2,7,12,15-tetraoxa-10-aza-11λ5-phosphabicyclo[12.3.0]heptadecane-3,8-dione |
|---|---|
| PubChem CID | 134414836 |
| Molecular Formula | C23H27FN3O10P |
| Molecular Weight | 555.45 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | (1R,9S,11S,14R,16R,17R)-16-(2,4-dioxopyrimidin-1-yl)-17-fluoro-9,17-dimethyl-11-oxo-11-phenoxy-2,7,12,15-tetraoxa-10-aza-11λ5-phosphabicyclo[12.3.0]heptadecane-3,8-dione |
| SMILES | C[C@@H]1N[P@@](=O)(Oc2ccccc2)OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@](C)(F)[C@@H]2OC(=O)CCCOC1=O |
| InChI | InChI=1S/C23H27FN3O10P/c1-14-20(30)33-12-6-9-18(29)36-19-16(13-34-38(32,26-14)37-15-7-4-3-5-8-15)35-21(23(19,2)24)27-11-10-17(28)25-22(27)31/h3-5,7-8,10-11,14,16,19,21H,6,9,12-13H2,1-2H3,(H,26,32)(H,25,28,31)/t14-,16+,19+,21+,23+,38-/m0/s1 |
| InChIKey | DSLXGBLBKVYJND-XUCXFOHOSA-N |
| XLogP | 1.59 |
| TPSA | 164.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|