About N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide
N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide (PubChem CID 134414908) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide.
Molecular Properties
| Compound Name | N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide |
| PubChem CID | 134414908 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide |
| SMILES | C/C=C\C(C=O)=C/N(C=O)CC |
| InChI | InChI=1S/C9H13NO2/c1-3-5-9(7-11)6-10(4-2)8-12/h3,5-8H,4H2,1-2H3/b5-3-,9-6+ |
| InChIKey | RVMNZVBFZPNYRR-PAEKIZANSA-N |
| XLogP | 1.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide?
The IUPAC name of N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide (CID 134414908) is N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide.
What is the SMILES notation for N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide?
The canonical SMILES for N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide is C/C=C\C(C=O)=C/N(C=O)CC.
What is the InChIKey of N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide?
The InChIKey is RVMNZVBFZPNYRR-PAEKIZANSA-N. The full InChI is InChI=1S/C9H13NO2/c1-3-5-9(7-11)6-10(4-2)8-12/h3,5-8H,4H2,1-2H3/b5-3-,9-6+.
What are the key properties of N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide?
N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide has a molecular weight of 167.21 g/mol, XLogP of 1.12, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[(1E,3Z)-2-formylpenta-1,3-dienyl]formamide is sourced from PubChem (CID 134414908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).