C12H18N6S — CID 134414944
4-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-6-ethylpyrimidine-2,4-diamine (PubChem CID 134414944) has the molecular formula C12H18N6S and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-6-ethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-6-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134414944 |
| Molecular Formula | C12H18N6S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-6-ethylpyrimidine-2,4-diamine |
| SMILES | CCc1cc(NCCCc2csc(N)n2)nc(N)n1 |
| InChI | InChI=1S/C12H18N6S/c1-2-8-6-10(18-11(13)16-8)15-5-3-4-9-7-19-12(14)17-9/h6-7H,2-5H2,1H3,(H2,14,17)(H3,13,15,16,18) |
| InChIKey | RSIOGQDNASJWIX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|