About O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate
O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate (PubChem CID 13441495) has the molecular formula C11H22OS2
and a molecular weight of 234.43 g/mol. Its IUPAC name is O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate.
Molecular Properties
| Compound Name | O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate |
| PubChem CID | 13441495 |
| Molecular Formula | C11H22OS2 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate |
| SMILES | CC(C)CCOC(=S)SCCC(C)C |
| InChI | InChI=1S/C11H22OS2/c1-9(2)5-7-12-11(13)14-8-6-10(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | JKVBYKVXZLJGHF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate?
The IUPAC name of O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate (CID 13441495) is O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate.
What is the SMILES notation for O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate?
The canonical SMILES for O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate is CC(C)CCOC(=S)SCCC(C)C.
What is the InChIKey of O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate?
The InChIKey is JKVBYKVXZLJGHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22OS2/c1-9(2)5-7-12-11(13)14-8-6-10(3)4/h9-10H,5-8H2,1-4H3.
What are the key properties of O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate?
O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate has a molecular weight of 234.43 g/mol, XLogP of 4.11, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(3-methylbutyl) 3-methylbutylsulfanylmethanethioate is sourced from PubChem (CID 13441495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).