C15H28FN — CID 134415122
(3E,5E)-6-tert-butyl-4-fluoro-2,2-dimethylnona-3,5-dien-3-amine (PubChem CID 134415122) has the molecular formula C15H28FN and a molecular weight of 241.39 g/mol. Its IUPAC name is (3E,5E)-6-tert-butyl-4-fluoro-2,2-dimethylnona-3,5-dien-3-amine.
| Compound Name | (3E,5E)-6-tert-butyl-4-fluoro-2,2-dimethylnona-3,5-dien-3-amine |
|---|---|
| PubChem CID | 134415122 |
| Molecular Formula | C15H28FN |
| Molecular Weight | 241.39 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | (3E,5E)-6-tert-butyl-4-fluoro-2,2-dimethylnona-3,5-dien-3-amine |
| SMILES | CCC/C(=C\C(F)=C(/N)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H28FN/c1-8-9-11(14(2,3)4)10-12(16)13(17)15(5,6)7/h10H,8-9,17H2,1-7H3/b11-10+,13-12+ |
| InChIKey | AWZSSVHFFIVOTN-AQASXUMVSA-N |
| XLogP | 4.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|