About 2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole
2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole (PubChem CID 134415209) has the molecular formula C15H18F3NS
and a molecular weight of 301.38 g/mol. Its IUPAC name is 2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole |
| PubChem CID | 134415209 |
| Molecular Formula | C15H18F3NS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole |
| SMILES | CC(C)c1cc(C(F)(F)F)c2nc(C(C)(C)C)sc2c1 |
| InChI | InChI=1S/C15H18F3NS/c1-8(2)9-6-10(15(16,17)18)12-11(7-9)20-13(19-12)14(3,4)5/h6-8H,1-5H3 |
| InChIKey | YZGXWOMFWFJXIK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole?
The IUPAC name of 2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole (CID 134415209) is 2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole.
What is the SMILES notation for 2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole?
The canonical SMILES for 2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole is CC(C)c1cc(C(F)(F)F)c2nc(C(C)(C)C)sc2c1.
What is the InChIKey of 2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole?
The InChIKey is YZGXWOMFWFJXIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F3NS/c1-8(2)9-6-10(15(16,17)18)12-11(7-9)20-13(19-12)14(3,4)5/h6-8H,1-5H3.
What are the key properties of 2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole?
2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole has a molecular weight of 301.38 g/mol, XLogP of 5.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-propan-2-yl-4-(trifluoromethyl)-1,3-benzothiazole is sourced from PubChem (CID 134415209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).