C9H14N2 — CID 134415586
(2Z,4Z)-1-imino-2,6-dimethylhepta-2,4,6-trien-3-amine (PubChem CID 134415586) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (2Z,4Z)-1-imino-2,6-dimethylhepta-2,4,6-trien-3-amine.
| Compound Name | (2Z,4Z)-1-imino-2,6-dimethylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 134415586 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (2Z,4Z)-1-imino-2,6-dimethylhepta-2,4,6-trien-3-amine |
| SMILES | [H]/N=C/C(C)=C(N)/C=C\C(=C)C |
| InChI | InChI=1S/C9H14N2/c1-7(2)4-5-9(11)8(3)6-10/h4-6,10H,1,11H2,2-3H3/b5-4-,9-8-,10-6+ |
| InChIKey | FIKVPLIDGQXZIU-SWAHPALJSA-N |
| XLogP | 2.00 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|