C32H37NO2 — CID 134415609
(8S,9R,10R,11S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-17-prop-1-ynyl-11-(4-pyrrol-1-ylphenyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 134415609) has the molecular formula C32H37NO2 and a molecular weight of 467.65 g/mol. Its IUPAC name is (8S,9R,10R,11S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-17-prop-1-ynyl-11-(4-pyrrol-1-ylphenyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10R,11S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-17-prop-1-ynyl-11-(4-pyrrol-1-ylphenyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 134415609 |
| Molecular Formula | C32H37NO2 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | (8S,9R,10R,11S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-17-prop-1-ynyl-11-(4-pyrrol-1-ylphenyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](c3ccc(-n4cccc4)cc3)C[C@@]21C |
| InChI | InChI=1S/C32H37NO2/c1-4-15-32(35)17-14-28-26-12-9-23-20-25(34)13-16-30(23,2)29(26)27(21-31(28,32)3)22-7-10-24(11-8-22)33-18-5-6-19-33/h5-8,10-11,18-20,26-29,35H,9,12-14,16-17,21H2,1-3H3/t26-,27+,28-,29+,30-,31-,32-/m0/s1 |
| InChIKey | PDQVCFOQIMKRGZ-XVFXGUTESA-N |
| XLogP | 6.46 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|