C18H14ClF3N2O2 — CID 134416121
(3S,4S)-4-(4-chlorophenyl)-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 134416121) has the molecular formula C18H14ClF3N2O2 and a molecular weight of 382.77 g/mol. Its IUPAC name is (3S,4S)-4-(4-chlorophenyl)-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-4-(4-chlorophenyl)-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134416121 |
| Molecular Formula | C18H14ClF3N2O2 |
| Molecular Weight | 382.77 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | (3S,4S)-4-(4-chlorophenyl)-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | CN1C[C@H](c2ccc(Cl)cc2)[C@@H](C(=O)Nc2ccc(F)c(F)c2F)C1=O |
| InChI | InChI=1S/C18H14ClF3N2O2/c1-24-8-11(9-2-4-10(19)5-3-9)14(18(24)26)17(25)23-13-7-6-12(20)15(21)16(13)22/h2-7,11,14H,8H2,1H3,(H,23,25)/t11-,14+/m1/s1 |
| InChIKey | RNDJYXLHXQCYLD-RISCZKNCSA-N |
| XLogP | 3.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.77 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|