About 5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol
5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol (PubChem CID 134416227) has the molecular formula C16H34O3
and a molecular weight of 274.44 g/mol. Its IUPAC name is 5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol.
Molecular Properties
| Compound Name | 5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol |
| PubChem CID | 134416227 |
| Molecular Formula | C16H34O3 |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.25 |
| IUPAC Name | 5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol |
| SMILES | CCC(O)CC(C)(CC)OCC(O)CC(C)(C)CC |
| InChI | InChI=1S/C16H34O3/c1-7-13(17)11-16(6,9-3)19-12-14(18)10-15(4,5)8-2/h13-14,17-18H,7-12H2,1-6H3 |
| InChIKey | OXDLBWMAYSVBBE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol?
The IUPAC name of 5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol (CID 134416227) is 5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol.
What is the SMILES notation for 5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol?
The canonical SMILES for 5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol is CCC(O)CC(C)(CC)OCC(O)CC(C)(C)CC.
What is the InChIKey of 5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol?
The InChIKey is OXDLBWMAYSVBBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O3/c1-7-13(17)11-16(6,9-3)19-12-14(18)10-15(4,5)8-2/h13-14,17-18H,7-12H2,1-6H3.
What are the key properties of 5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol?
5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol has a molecular weight of 274.44 g/mol, XLogP of 3.52, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-hydroxy-4,4-dimethylhexoxy)-5-methylheptan-3-ol is sourced from PubChem (CID 134416227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).