About 3-chloro-2-phenyl-1,8a-dihydroquinoxaline
3-chloro-2-phenyl-1,8a-dihydroquinoxaline (PubChem CID 134416710) has the molecular formula C14H11ClN2
and a molecular weight of 242.71 g/mol. Its IUPAC name is 3-chloro-2-phenyl-1,8a-dihydroquinoxaline.
Molecular Properties
| Compound Name | 3-chloro-2-phenyl-1,8a-dihydroquinoxaline |
| PubChem CID | 134416710 |
| Molecular Formula | C14H11ClN2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3-chloro-2-phenyl-1,8a-dihydroquinoxaline |
| SMILES | ClC1=C(c2ccccc2)NC2C=CC=CC2=N1 |
| InChI | InChI=1S/C14H11ClN2/c15-14-13(10-6-2-1-3-7-10)16-11-8-4-5-9-12(11)17-14/h1-9,11,16H |
| InChIKey | KWBCYGIVJFPGGH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-phenyl-1,8a-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-phenyl-1,8a-dihydroquinoxaline?
The IUPAC name of 3-chloro-2-phenyl-1,8a-dihydroquinoxaline (CID 134416710) is 3-chloro-2-phenyl-1,8a-dihydroquinoxaline.
What is the SMILES notation for 3-chloro-2-phenyl-1,8a-dihydroquinoxaline?
The canonical SMILES for 3-chloro-2-phenyl-1,8a-dihydroquinoxaline is ClC1=C(c2ccccc2)NC2C=CC=CC2=N1.
What is the InChIKey of 3-chloro-2-phenyl-1,8a-dihydroquinoxaline?
The InChIKey is KWBCYGIVJFPGGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClN2/c15-14-13(10-6-2-1-3-7-10)16-11-8-4-5-9-12(11)17-14/h1-9,11,16H.
What are the key properties of 3-chloro-2-phenyl-1,8a-dihydroquinoxaline?
3-chloro-2-phenyl-1,8a-dihydroquinoxaline has a molecular weight of 242.71 g/mol, XLogP of 3.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-phenyl-1,8a-dihydroquinoxaline is sourced from PubChem (CID 134416710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).