C20H21ClN2O4 — CID 134416891
N-[[(2R,5R)-5-(benzamidomethyl)-1,4-dioxan-2-yl]methyl]-2-chlorobenzamide (PubChem CID 134416891) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is N-[[(2R,5R)-5-(benzamidomethyl)-1,4-dioxan-2-yl]methyl]-2-chlorobenzamide.
| Compound Name | N-[[(2R,5R)-5-(benzamidomethyl)-1,4-dioxan-2-yl]methyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 134416891 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[[(2R,5R)-5-(benzamidomethyl)-1,4-dioxan-2-yl]methyl]-2-chlorobenzamide |
| SMILES | O=C(NC[C@@H]1CO[C@H](CNC(=O)c2ccccc2Cl)CO1)c1ccccc1 |
| InChI | InChI=1S/C20H21ClN2O4/c21-18-9-5-4-8-17(18)20(25)23-11-16-13-26-15(12-27-16)10-22-19(24)14-6-2-1-3-7-14/h1-9,15-16H,10-13H2,(H,22,24)(H,23,25)/t15-,16-/m1/s1 |
| InChIKey | XQFCSFCNEMQPAG-HZPDHXFCSA-N |
| XLogP | 2.28 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |