About 5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine
5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 134417012) has the molecular formula C16H14N4
and a molecular weight of 262.32 g/mol. Its IUPAC name is 5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 134417012 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Cc1cnc2[nH]ccc2c1Cn1ccc2ccncc21 |
| InChI | InChI=1S/C16H14N4/c1-11-8-19-16-13(3-6-18-16)14(11)10-20-7-4-12-2-5-17-9-15(12)20/h2-9H,10H2,1H3,(H,18,19) |
| InChIKey | NFDOXSUCUZYOHT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine (CID 134417012) is 5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine is Cc1cnc2[nH]ccc2c1Cn1ccc2ccncc21.
What is the InChIKey of 5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is NFDOXSUCUZYOHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4/c1-11-8-19-16-13(3-6-18-16)14(11)10-20-7-4-12-2-5-17-9-15(12)20/h2-9H,10H2,1H3,(H,18,19).
What are the key properties of 5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine?
5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 262.32 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-(pyrrolo[2,3-c]pyridin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 134417012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).