C22H27F3N6O3 — CID 134417048
N-[7-[(1R,2S,3R,4R)-4-[[ethenyl-(3-methyl-1-methyliminobut-2-en-2-yl)amino]methyl]-2,3-dihydroxycyclopentyl]pyrrolo[2,3-d]pyrimidin-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 134417048) has the molecular formula C22H27F3N6O3 and a molecular weight of 480.49 g/mol. Its IUPAC name is N-[7-[(1R,2S,3R,4R)-4-[[ethenyl-(3-methyl-1-methyliminobut-2-en-2-yl)amino]methyl]-2,3-dihydroxycyclopentyl]pyrrolo[2,3-d]pyrimidin-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[7-[(1R,2S,3R,4R)-4-[[ethenyl-(3-methyl-1-methyliminobut-2-en-2-yl)amino]methyl]-2,3-dihydroxycyclopentyl]pyrrolo[2,3-d]pyrimidin-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 134417048 |
| Molecular Formula | C22H27F3N6O3 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | N-[7-[(1R,2S,3R,4R)-4-[[ethenyl-(3-methyl-1-methyliminobut-2-en-2-yl)amino]methyl]-2,3-dihydroxycyclopentyl]pyrrolo[2,3-d]pyrimidin-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | C=CN(C[C@H]1C[C@@H](n2ccc3c(NC(=O)C(F)(F)F)ncnc32)[C@H](O)[C@@H]1O)C(/C=N/C)=C(C)C |
| InChI | InChI=1S/C22H27F3N6O3/c1-5-30(16(9-26-4)12(2)3)10-13-8-15(18(33)17(13)32)31-7-6-14-19(27-11-28-20(14)31)29-21(34)22(23,24)25/h5-7,9,11,13,15,17-18,32-33H,1,8,10H2,2-4H3,(H,27,28,29,34)/b26-9+/t13-,15-,17-,18+/m1/s1 |
| InChIKey | ZFBOWCVNJIQPSY-USSSTYPLSA-N |
| XLogP | 2.65 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|