C10H15ClN2O4S3 — CID 134417106
(4S,6S)-4-[chloro(ethyl)amino]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 134417106) has the molecular formula C10H15ClN2O4S3 and a molecular weight of 358.89 g/mol. Its IUPAC name is (4S,6S)-4-[chloro(ethyl)amino]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | (4S,6S)-4-[chloro(ethyl)amino]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 134417106 |
| Molecular Formula | C10H15ClN2O4S3 |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | (4S,6S)-4-[chloro(ethyl)amino]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | CCN(Cl)[C@H]1C[C@H](C)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C10H15ClN2O4S3/c1-3-13(11)8-4-6(2)19(14,15)10-7(8)5-9(18-10)20(12,16)17/h5-6,8H,3-4H2,1-2H3,(H2,12,16,17)/t6-,8-/m0/s1 |
| InChIKey | CZHIQVODAXFRKS-XPUUQOCRSA-N |
| XLogP | 1.48 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|