C26H32Br2O2 — CID 134417176
7-bromo-5-(3-bromo-2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)-6-(2-methylbutan-2-yloxy)-1,2,3,4-tetrahydronaphthalene (PubChem CID 134417176) has the molecular formula C26H32Br2O2 and a molecular weight of 536.35 g/mol. Its IUPAC name is 7-bromo-5-(3-bromo-2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)-6-(2-methylbutan-2-yloxy)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 7-bromo-5-(3-bromo-2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)-6-(2-methylbutan-2-yloxy)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 134417176 |
| Molecular Formula | C26H32Br2O2 |
| Molecular Weight | 536.35 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | 7-bromo-5-(3-bromo-2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)-6-(2-methylbutan-2-yloxy)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCC(C)(C)Oc1c(Br)cc2c(c1-c1c3c(cc(Br)c1OC)CCCC3)CCCC2 |
| InChI | InChI=1S/C26H32Br2O2/c1-5-26(2,3)30-25-21(28)15-17-11-7-9-13-19(17)23(25)22-18-12-8-6-10-16(18)14-20(27)24(22)29-4/h14-15H,5-13H2,1-4H3 |
| InChIKey | UGCHHGVDVFQMLA-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.35 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |