About N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine
N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine (PubChem CID 134417293) has the molecular formula C19H28N2
and a molecular weight of 284.45 g/mol. Its IUPAC name is N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine.
Molecular Properties
| Compound Name | N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine |
| PubChem CID | 134417293 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine |
| SMILES | C=N/C(=C\C=C(C)C)C(C)CCc1cccc(C(C)C)n1 |
| InChI | InChI=1S/C19H28N2/c1-14(2)10-13-19(20-6)16(5)11-12-17-8-7-9-18(21-17)15(3)4/h7-10,13,15-16H,6,11-12H2,1-5H3/b19-13- |
| InChIKey | LYVCDASGSFPDEB-UYRXBGFRSA-N |
| XLogP | 5.32 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine?
The IUPAC name of N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine (CID 134417293) is N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine.
What is the SMILES notation for N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine?
The canonical SMILES for N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine is C=N/C(=C\C=C(C)C)C(C)CCc1cccc(C(C)C)n1.
What is the InChIKey of N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine?
The InChIKey is LYVCDASGSFPDEB-UYRXBGFRSA-N. The full InChI is InChI=1S/C19H28N2/c1-14(2)10-13-19(20-6)16(5)11-12-17-8-7-9-18(21-17)15(3)4/h7-10,13,15-16H,6,11-12H2,1-5H3/b19-13-.
What are the key properties of N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine?
N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine has a molecular weight of 284.45 g/mol, XLogP of 5.32, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4Z)-3,7-dimethyl-1-(6-propan-2-yl-2-pyridinyl)octa-4,6-dien-4-yl]methanimine is sourced from PubChem (CID 134417293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).